C13H25N — CID 106778439
2-(3-methylbutyl)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine (PubChem CID 106778439) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 2-(3-methylbutyl)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine.
| Compound Name | 2-(3-methylbutyl)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 106778439 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 2-(3-methylbutyl)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine |
| SMILES | CC(C)CCC1CCC2CCCC2N1 |
| InChI | InChI=1S/C13H25N/c1-10(2)6-8-12-9-7-11-4-3-5-13(11)14-12/h10-14H,3-9H2,1-2H3 |
| InChIKey | AXYXJZOOJIJVRO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |