C9H17NS — CID 89216652
2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridin-2-ylmethanethiol (PubChem CID 89216652) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridin-2-ylmethanethiol.
| Compound Name | 2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridin-2-ylmethanethiol |
|---|---|
| PubChem CID | 89216652 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridin-2-ylmethanethiol |
| SMILES | SCC1CCC2CCCC2N1 |
| InChI | InChI=1S/C9H17NS/c11-6-8-5-4-7-2-1-3-9(7)10-8/h7-11H,1-6H2 |
| InChIKey | DUXTWTOIBQYRAS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|