C8H8ClN3 — CID 67501802
4-chloro-3-ethyl-2H-pyrazolo[3,4-b]pyridine (PubChem CID 67501802) has the molecular formula C8H8ClN3 and a molecular weight of 181.63 g/mol. Its IUPAC name is 4-chloro-3-ethyl-2H-pyrazolo[3,4-b]pyridine.
| Compound Name | 4-chloro-3-ethyl-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 67501802 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 4-chloro-3-ethyl-2H-pyrazolo[3,4-b]pyridine |
| SMILES | CCc1[nH]nc2nccc(Cl)c12 |
| InChI | InChI=1S/C8H8ClN3/c1-2-6-7-5(9)3-4-10-8(7)12-11-6/h3-4H,2H2,1H3,(H,10,11,12) |
| InChIKey | RSOGLSFAQKGHCU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |