C21H23N5O2S — CID 67502648
6-[4-(oxan-4-yl)anilino]-4-(1,3-thiazol-2-ylmethylamino)pyridine-3-carboxamide (PubChem CID 67502648) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is 6-[4-(oxan-4-yl)anilino]-4-(1,3-thiazol-2-ylmethylamino)pyridine-3-carboxamide.
| Compound Name | 6-[4-(oxan-4-yl)anilino]-4-(1,3-thiazol-2-ylmethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67502648 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 6-[4-(oxan-4-yl)anilino]-4-(1,3-thiazol-2-ylmethylamino)pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(Nc2ccc(C3CCOCC3)cc2)cc1NCc1nccs1 |
| InChI | InChI=1S/C21H23N5O2S/c22-21(27)17-12-25-19(11-18(17)24-13-20-23-7-10-29-20)26-16-3-1-14(2-4-16)15-5-8-28-9-6-15/h1-4,7,10-12,15H,5-6,8-9,13H2,(H2,22,27)(H2,24,25,26) |
| InChIKey | MRZMTNBUSBYZHE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |