About CID 67504586
CID 67504586 (PubChem CID 67504586) has the molecular formula C6H3BrNO2S3-
and a molecular weight of 297.20 g/mol.
Molecular Properties
| Compound Name | CID 67504586 |
| PubChem CID | 67504586 |
| Molecular Formula | C6H3BrNO2S3- |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 295.85 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1[S-](=S)=S |
| InChI | InChI=1S/C6H3BrNO2S3/c7-4-1-2-6(13(11)12)5(3-4)8(9)10/h1-3H/q-1 |
| InChIKey | ZIYAGMAIUKSYLP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 67504586 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67504586?
The IUPAC name of CID 67504586 (CID 67504586) is not available.
What is the SMILES notation for CID 67504586?
The canonical SMILES for CID 67504586 is O=[N+]([O-])c1cc(Br)ccc1[S-](=S)=S.
What is the InChIKey of CID 67504586?
The InChIKey is ZIYAGMAIUKSYLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrNO2S3/c7-4-1-2-6(13(11)12)5(3-4)8(9)10/h1-3H/q-1.
What are the key properties of CID 67504586?
CID 67504586 has a molecular weight of 297.20 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67504586 is sourced from PubChem (CID 67504586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).