C18H20F3N3O2 — CID 67504975
5-[methyl(3-methylbutyl)amino]-6-[4-(trifluoromethyl)phenyl]pyrazine-2-carboxylic acid (PubChem CID 67504975) has the molecular formula C18H20F3N3O2 and a molecular weight of 367.37 g/mol. Its IUPAC name is 5-[methyl(3-methylbutyl)amino]-6-[4-(trifluoromethyl)phenyl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[methyl(3-methylbutyl)amino]-6-[4-(trifluoromethyl)phenyl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 67504975 |
| Molecular Formula | C18H20F3N3O2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 5-[methyl(3-methylbutyl)amino]-6-[4-(trifluoromethyl)phenyl]pyrazine-2-carboxylic acid |
| SMILES | CC(C)CCN(C)c1ncc(C(=O)O)nc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H20F3N3O2/c1-11(2)8-9-24(3)16-15(23-14(10-22-16)17(25)26)12-4-6-13(7-5-12)18(19,20)21/h4-7,10-11H,8-9H2,1-3H3,(H,25,26) |
| InChIKey | QEWVPFBRZJGCSB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |