C16H14ClNO2 — CID 67507287
(2S)-2-[(4-chlorophenyl)methylideneamino]-3-phenylpropanoic acid (PubChem CID 67507287) has the molecular formula C16H14ClNO2 and a molecular weight of 287.75 g/mol. Its IUPAC name is (2S)-2-[(4-chlorophenyl)methylideneamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(4-chlorophenyl)methylideneamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 67507287 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | (2S)-2-[(4-chlorophenyl)methylideneamino]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClNO2/c17-14-8-6-13(7-9-14)11-18-15(16(19)20)10-12-4-2-1-3-5-12/h1-9,11,15H,10H2,(H,19,20)/b18-11+/t15-/m0/s1 |
| InChIKey | UBAYGTWBBVISPB-LZNAANCOSA-N |
| XLogP | 3.45 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|