C24H27FN2O4S — CID 67511570
1-[6-fluoro-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-phenylquinolin-4-yl]ethanesulfinic acid (PubChem CID 67511570) has the molecular formula C24H27FN2O4S and a molecular weight of 458.56 g/mol. Its IUPAC name is 1-[6-fluoro-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-phenylquinolin-4-yl]ethanesulfinic acid.
| Compound Name | 1-[6-fluoro-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-phenylquinolin-4-yl]ethanesulfinic acid |
|---|---|
| PubChem CID | 67511570 |
| Molecular Formula | C24H27FN2O4S |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 1-[6-fluoro-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-3-phenylquinolin-4-yl]ethanesulfinic acid |
| SMILES | CC(c1c(-c2ccccc2)c(CCNC(=O)OC(C)(C)C)nc2ccc(F)cc12)S(=O)O |
| InChI | InChI=1S/C24H27FN2O4S/c1-15(32(29)30)21-18-14-17(25)10-11-19(18)27-20(22(21)16-8-6-5-7-9-16)12-13-26-23(28)31-24(2,3)4/h5-11,14-15H,12-13H2,1-4H3,(H,26,28)(H,29,30) |
| InChIKey | UAJRGYPQGQAIPD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|