C23H25FN2O3 — CID 67510865
tert-butyl N-[2-[6-fluoro-4-(hydroxymethyl)-3-phenylquinolin-2-yl]ethyl]carbamate (PubChem CID 67510865) has the molecular formula C23H25FN2O3 and a molecular weight of 396.46 g/mol. Its IUPAC name is tert-butyl N-[2-[6-fluoro-4-(hydroxymethyl)-3-phenylquinolin-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[6-fluoro-4-(hydroxymethyl)-3-phenylquinolin-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 67510865 |
| Molecular Formula | C23H25FN2O3 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | tert-butyl N-[2-[6-fluoro-4-(hydroxymethyl)-3-phenylquinolin-2-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1nc2ccc(F)cc2c(CO)c1-c1ccccc1 |
| InChI | InChI=1S/C23H25FN2O3/c1-23(2,3)29-22(28)25-12-11-20-21(15-7-5-4-6-8-15)18(14-27)17-13-16(24)9-10-19(17)26-20/h4-10,13,27H,11-12,14H2,1-3H3,(H,25,28) |
| InChIKey | GBLPQHDWSZBMFN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |