C34H28F5N5O6 — CID 67511612
[2-[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylanilino]-1-(3-methylphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate (PubChem CID 67511612) has the molecular formula C34H28F5N5O6 and a molecular weight of 697.62 g/mol. Its IUPAC name is [2-[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylanilino]-1-(3-methylphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylanilino]-1-(3-methylphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67511612 |
| Molecular Formula | C34H28F5N5O6 |
| Molecular Weight | 697.62 g/mol |
| Exact Mass | 697.20 |
| IUPAC Name | [2-[3-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-4-methylanilino]-1-(3-methylphenyl)-2-oxoethyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cccc(C(OC(=O)C(F)(F)F)C(=O)Nc2ccc(C)c(-c3nc(NC(CO)CO)nc4c3ccc(=O)n4-c3c(F)cccc3F)c2)c1 |
| InChI | InChI=1S/C34H28F5N5O6/c1-17-5-3-6-19(13-17)29(50-32(49)34(37,38)39)31(48)40-20-10-9-18(2)23(14-20)27-22-11-12-26(47)44(28-24(35)7-4-8-25(28)36)30(22)43-33(42-27)41-21(15-45)16-46/h3-14,21,29,45-46H,15-16H2,1-2H3,(H,40,48)(H,41,42,43) |
| InChIKey | MNDPTFXIYQPAOQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 155.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |