C19H16N2O3S — CID 67512847
2-(3-cyano-1-methoxy-4-phenylcyclohexa-2,5-dien-1-yl)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 67512847) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-(3-cyano-1-methoxy-4-phenylcyclohexa-2,5-dien-1-yl)-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(3-cyano-1-methoxy-4-phenylcyclohexa-2,5-dien-1-yl)-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 67512847 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-(3-cyano-1-methoxy-4-phenylcyclohexa-2,5-dien-1-yl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | COC1(c2nc(C)c(C(=O)O)s2)C=CC(c2ccccc2)C(C#N)=C1 |
| InChI | InChI=1S/C19H16N2O3S/c1-12-16(17(22)23)25-18(21-12)19(24-2)9-8-15(14(10-19)11-20)13-6-4-3-5-7-13/h3-10,15H,1-2H3,(H,22,23) |
| InChIKey | CQQPZULNIREKRL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|