C19H20N2O — CID 18328394
3-(2-methylbutoxy)-6-phenylcyclohexa-1,4-diene-1,3-dicarbonitrile (PubChem CID 18328394) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-(2-methylbutoxy)-6-phenylcyclohexa-1,4-diene-1,3-dicarbonitrile.
| Compound Name | 3-(2-methylbutoxy)-6-phenylcyclohexa-1,4-diene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 18328394 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 3-(2-methylbutoxy)-6-phenylcyclohexa-1,4-diene-1,3-dicarbonitrile |
| SMILES | CCC(C)COC1(C#N)C=CC(c2ccccc2)C(C#N)=C1 |
| InChI | InChI=1S/C19H20N2O/c1-3-15(2)13-22-19(14-21)10-9-18(17(11-19)12-20)16-7-5-4-6-8-16/h4-11,15,18H,3,13H2,1-2H3 |
| InChIKey | BDOODZGRRYKZTA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|