C18H27NO7S — CID 67514451
[2-hydroxy-1-[3-methyl-4-(phenylmethoxycarbonylamino)butyl]sulfonylpropyl] acetate (PubChem CID 67514451) has the molecular formula C18H27NO7S and a molecular weight of 401.48 g/mol. Its IUPAC name is [2-hydroxy-1-[3-methyl-4-(phenylmethoxycarbonylamino)butyl]sulfonylpropyl] acetate.
| Compound Name | [2-hydroxy-1-[3-methyl-4-(phenylmethoxycarbonylamino)butyl]sulfonylpropyl] acetate |
|---|---|
| PubChem CID | 67514451 |
| Molecular Formula | C18H27NO7S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [2-hydroxy-1-[3-methyl-4-(phenylmethoxycarbonylamino)butyl]sulfonylpropyl] acetate |
| SMILES | CC(=O)OC(C(C)O)S(=O)(=O)CCC(C)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H27NO7S/c1-13(9-10-27(23,24)17(14(2)20)26-15(3)21)11-19-18(22)25-12-16-7-5-4-6-8-16/h4-8,13-14,17,20H,9-12H2,1-3H3,(H,19,22) |
| InChIKey | HVYPSFFUHILHGH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |