About 5-(imidazol-1-ylmethyl)-2,3-diphenylpyridine
5-(imidazol-1-ylmethyl)-2,3-diphenylpyridine (PubChem CID 67515869) has the molecular formula C21H17N3
and a molecular weight of 311.39 g/mol. Its IUPAC name is 5-(imidazol-1-ylmethyl)-2,3-diphenylpyridine.
Molecular Properties
| Compound Name | 5-(imidazol-1-ylmethyl)-2,3-diphenylpyridine |
| PubChem CID | 67515869 |
| Molecular Formula | C21H17N3 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 5-(imidazol-1-ylmethyl)-2,3-diphenylpyridine |
| SMILES | c1ccc(-c2cc(Cn3ccnc3)cnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17N3/c1-3-7-18(8-4-1)20-13-17(15-24-12-11-22-16-24)14-23-21(20)19-9-5-2-6-10-19/h1-14,16H,15H2 |
| InChIKey | VOUNNULXUYBOJJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(imidazol-1-ylmethyl)-2,3-diphenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(imidazol-1-ylmethyl)-2,3-diphenylpyridine?
The IUPAC name of 5-(imidazol-1-ylmethyl)-2,3-diphenylpyridine (CID 67515869) is 5-(imidazol-1-ylmethyl)-2,3-diphenylpyridine.
What is the SMILES notation for 5-(imidazol-1-ylmethyl)-2,3-diphenylpyridine?
The canonical SMILES for 5-(imidazol-1-ylmethyl)-2,3-diphenylpyridine is c1ccc(-c2cc(Cn3ccnc3)cnc2-c2ccccc2)cc1.
What is the InChIKey of 5-(imidazol-1-ylmethyl)-2,3-diphenylpyridine?
The InChIKey is VOUNNULXUYBOJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3/c1-3-7-18(8-4-1)20-13-17(15-24-12-11-22-16-24)14-23-21(20)19-9-5-2-6-10-19/h1-14,16H,15H2.
What are the key properties of 5-(imidazol-1-ylmethyl)-2,3-diphenylpyridine?
5-(imidazol-1-ylmethyl)-2,3-diphenylpyridine has a molecular weight of 311.39 g/mol, XLogP of 4.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(imidazol-1-ylmethyl)-2,3-diphenylpyridine is sourced from PubChem (CID 67515869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).