C13H19F3O2 — CID 67518551
2-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2-(trifluoromethyl)butanoic acid (PubChem CID 67518551) has the molecular formula C13H19F3O2 and a molecular weight of 264.29 g/mol. Its IUPAC name is 2-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2-(trifluoromethyl)butanoic acid.
| Compound Name | 2-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2-(trifluoromethyl)butanoic acid |
|---|---|
| PubChem CID | 67518551 |
| Molecular Formula | C13H19F3O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-(3-methyl-2-bicyclo[2.2.1]heptanyl)-2-(trifluoromethyl)butanoic acid |
| SMILES | CCC(C(=O)O)(C1C2CCC(C2)C1C)C(F)(F)F |
| InChI | InChI=1S/C13H19F3O2/c1-3-12(11(17)18,13(14,15)16)10-7(2)8-4-5-9(10)6-8/h7-10H,3-6H2,1-2H3,(H,17,18) |
| InChIKey | FSJBHNCZYYKLMZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |