C23H28N2O5 — CID 67520039
[2-[[1-(2-methoxyethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]phenyl] acetate (PubChem CID 67520039) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is [2-[[1-(2-methoxyethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]phenyl] acetate.
| Compound Name | [2-[[1-(2-methoxyethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 67520039 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [2-[[1-(2-methoxyethyl)-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine-3-carbonyl]amino]phenyl] acetate |
| SMILES | COCCn1c2c(cc(C(=O)Nc3ccccc3OC(C)=O)c1=O)CCCCCC2 |
| InChI | InChI=1S/C23H28N2O5/c1-16(26)30-21-12-8-7-10-19(21)24-22(27)18-15-17-9-5-3-4-6-11-20(17)25(23(18)28)13-14-29-2/h7-8,10,12,15H,3-6,9,11,13-14H2,1-2H3,(H,24,27) |
| InChIKey | VPQFYFSBSVCRGU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|