C18H13ClFN5 — CID 67520624
3-(5-chloro-8-fluoroisoquinolin-3-yl)-5-(1-methylpyrazol-4-yl)pyridin-2-amine (PubChem CID 67520624) has the molecular formula C18H13ClFN5 and a molecular weight of 353.79 g/mol. Its IUPAC name is 3-(5-chloro-8-fluoroisoquinolin-3-yl)-5-(1-methylpyrazol-4-yl)pyridin-2-amine.
| Compound Name | 3-(5-chloro-8-fluoroisoquinolin-3-yl)-5-(1-methylpyrazol-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 67520624 |
| Molecular Formula | C18H13ClFN5 |
| Molecular Weight | 353.79 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 3-(5-chloro-8-fluoroisoquinolin-3-yl)-5-(1-methylpyrazol-4-yl)pyridin-2-amine |
| SMILES | Cn1cc(-c2cnc(N)c(-c3cc4c(Cl)ccc(F)c4cn3)c2)cn1 |
| InChI | InChI=1S/C18H13ClFN5/c1-25-9-11(7-24-25)10-4-13(18(21)23-6-10)17-5-12-14(8-22-17)16(20)3-2-15(12)19/h2-9H,1H3,(H2,21,23) |
| InChIKey | PBYAYEXPYYXQQY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.79 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |