C31H36N8O2 — CID 67523084
5-(3-imino-5,6-dihydrobenzo[h]cinnolin-2-yl)-N-[(1R,4S)-4-(4-pyrimidin-2-ylpiperazine-1-carbonyl)cyclopent-2-en-1-yl]pentanamide (PubChem CID 67523084) has the molecular formula C31H36N8O2 and a molecular weight of 552.68 g/mol. Its IUPAC name is 5-(3-imino-5,6-dihydrobenzo[h]cinnolin-2-yl)-N-[(1R,4S)-4-(4-pyrimidin-2-ylpiperazine-1-carbonyl)cyclopent-2-en-1-yl]pentanamide.
| Compound Name | 5-(3-imino-5,6-dihydrobenzo[h]cinnolin-2-yl)-N-[(1R,4S)-4-(4-pyrimidin-2-ylpiperazine-1-carbonyl)cyclopent-2-en-1-yl]pentanamide |
|---|---|
| PubChem CID | 67523084 |
| Molecular Formula | C31H36N8O2 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | 5-(3-imino-5,6-dihydrobenzo[h]cinnolin-2-yl)-N-[(1R,4S)-4-(4-pyrimidin-2-ylpiperazine-1-carbonyl)cyclopent-2-en-1-yl]pentanamide |
| SMILES | [H]/N=c1\cc2c(nn1CCCCC(=O)N[C@H]1C=C[C@@H](C(=O)N3CCN(c4ncccn4)CC3)C1)-c1ccccc1CC2 |
| InChI | InChI=1S/C31H36N8O2/c32-27-21-23-10-9-22-6-1-2-7-26(22)29(23)36-39(27)15-4-3-8-28(40)35-25-12-11-24(20-25)30(41)37-16-18-38(19-17-37)31-33-13-5-14-34-31/h1-2,5-7,11-14,21,24-25,32H,3-4,8-10,15-20H2,(H,35,40)/b32-27+/t24-,25+/m1/s1 |
| InChIKey | VNOKYDBMBGVLEJ-CEMHLAJOSA-N |
| XLogP | 2.50 |
| TPSA | 120.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|