C11H23BrN2 — CID 67523423
1-ethyl-3-hexyl-1,2-dihydroimidazol-1-ium bromide (PubChem CID 67523423) has the molecular formula C11H23BrN2 and a molecular weight of 263.22 g/mol. Its IUPAC name is 1-ethyl-3-hexyl-1,2-dihydroimidazol-1-ium bromide.
| Compound Name | 1-ethyl-3-hexyl-1,2-dihydroimidazol-1-ium bromide |
|---|---|
| PubChem CID | 67523423 |
| Molecular Formula | C11H23BrN2 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1-ethyl-3-hexyl-1,2-dihydroimidazol-1-ium bromide |
| SMILES | CCCCCCN1C=C[NH+](CC)C1.[Br-] |
| InChI | InChI=1S/C11H22N2.BrH/c1-3-5-6-7-8-13-10-9-12(4-2)11-13;/h9-10H,3-8,11H2,1-2H3;1H |
| InChIKey | XMEIBRYUYIYJFI-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|