C21H22F2N2O6S2 — CID 67526137
carbonic acid;5-[5-(1,1-difluoroethyl)-1,2-oxazol-3-yl]-N-[(1S,2R,3R)-2,3-dimethyl-2-phenylcyclopropyl]thiophene-2-sulfonamide (PubChem CID 67526137) has the molecular formula C21H22F2N2O6S2 and a molecular weight of 500.55 g/mol. Its IUPAC name is carbonic acid;5-[5-(1,1-difluoroethyl)-1,2-oxazol-3-yl]-N-[(1S,2R,3R)-2,3-dimethyl-2-phenylcyclopropyl]thiophene-2-sulfonamide.
| Compound Name | carbonic acid;5-[5-(1,1-difluoroethyl)-1,2-oxazol-3-yl]-N-[(1S,2R,3R)-2,3-dimethyl-2-phenylcyclopropyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 67526137 |
| Molecular Formula | C21H22F2N2O6S2 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | carbonic acid;5-[5-(1,1-difluoroethyl)-1,2-oxazol-3-yl]-N-[(1S,2R,3R)-2,3-dimethyl-2-phenylcyclopropyl]thiophene-2-sulfonamide |
| SMILES | C[C@H]1[C@H](NS(=O)(=O)c2ccc(-c3cc(C(C)(F)F)on3)s2)[C@@]1(C)c1ccccc1.O=C(O)O |
| InChI | InChI=1S/C20H20F2N2O3S2.CH2O3/c1-12-18(19(12,2)13-7-5-4-6-8-13)24-29(25,26)17-10-9-15(28-17)14-11-16(27-23-14)20(3,21)22;2-1(3)4/h4-12,18,24H,1-3H3;(H2,2,3,4)/t12-,18-,19+;/m0./s1 |
| InChIKey | MOGANTGNHISLSP-FLNIUOOPSA-N |
| XLogP | 4.99 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |