C20H20F2N2O3S2 — CID 67526138
5-[5-(1,1-difluoroethyl)-1,2-oxazol-3-yl]-N-[(1S,2R,3R)-2,3-dimethyl-2-phenylcyclopropyl]thiophene-2-sulfonamide (PubChem CID 67526138) has the molecular formula C20H20F2N2O3S2 and a molecular weight of 438.52 g/mol. Its IUPAC name is 5-[5-(1,1-difluoroethyl)-1,2-oxazol-3-yl]-N-[(1S,2R,3R)-2,3-dimethyl-2-phenylcyclopropyl]thiophene-2-sulfonamide.
| Compound Name | 5-[5-(1,1-difluoroethyl)-1,2-oxazol-3-yl]-N-[(1S,2R,3R)-2,3-dimethyl-2-phenylcyclopropyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 67526138 |
| Molecular Formula | C20H20F2N2O3S2 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 5-[5-(1,1-difluoroethyl)-1,2-oxazol-3-yl]-N-[(1S,2R,3R)-2,3-dimethyl-2-phenylcyclopropyl]thiophene-2-sulfonamide |
| SMILES | C[C@H]1[C@H](NS(=O)(=O)c2ccc(-c3cc(C(C)(F)F)on3)s2)[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C20H20F2N2O3S2/c1-12-18(19(12,2)13-7-5-4-6-8-13)24-29(25,26)17-10-9-15(28-17)14-11-16(27-23-14)20(3,21)22/h4-12,18,24H,1-3H3/t12-,18-,19+/m0/s1 |
| InChIKey | GWFFMFYNRYRHKA-YXKWSERDSA-N |
| XLogP | 4.77 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |