C19H29NO5 — CID 67527115
tert-butyl 2-[3-(3-hydroxy-1-morpholin-4-ylpropyl)phenoxy]acetate (PubChem CID 67527115) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is tert-butyl 2-[3-(3-hydroxy-1-morpholin-4-ylpropyl)phenoxy]acetate.
| Compound Name | tert-butyl 2-[3-(3-hydroxy-1-morpholin-4-ylpropyl)phenoxy]acetate |
|---|---|
| PubChem CID | 67527115 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | tert-butyl 2-[3-(3-hydroxy-1-morpholin-4-ylpropyl)phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1cccc(C(CCO)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H29NO5/c1-19(2,3)25-18(22)14-24-16-6-4-5-15(13-16)17(7-10-21)20-8-11-23-12-9-20/h4-6,13,17,21H,7-12,14H2,1-3H3 |
| InChIKey | MRIMYFXBUSRKRN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |