C19H27N7O4 — CID 67528738
N-[2-[2-[1-ethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carbonyl]hydrazinyl]-2-oxoethyl]-N-methylacetamide (PubChem CID 67528738) has the molecular formula C19H27N7O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is N-[2-[2-[1-ethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carbonyl]hydrazinyl]-2-oxoethyl]-N-methylacetamide.
| Compound Name | N-[2-[2-[1-ethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carbonyl]hydrazinyl]-2-oxoethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 67528738 |
| Molecular Formula | C19H27N7O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[2-[2-[1-ethyl-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carbonyl]hydrazinyl]-2-oxoethyl]-N-methylacetamide |
| SMILES | CCn1ncc2c(NC3CCOCC3)c(C(=O)NNC(=O)CN(C)C(C)=O)cnc21 |
| InChI | InChI=1S/C19H27N7O4/c1-4-26-18-14(10-21-26)17(22-13-5-7-30-8-6-13)15(9-20-18)19(29)24-23-16(28)11-25(3)12(2)27/h9-10,13H,4-8,11H2,1-3H3,(H,20,22)(H,23,28)(H,24,29) |
| InChIKey | CWZLYWXMONOBLT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|