C16H22N6O4S — CID 70343703
2-[2-[4-(cyclopentylamino)-1-ethylpyrazolo[3,4-b]pyridine-5-carbonyl]hydrazinyl]-2-oxoethanesulfinic acid (PubChem CID 70343703) has the molecular formula C16H22N6O4S and a molecular weight of 394.46 g/mol. Its IUPAC name is 2-[2-[4-(cyclopentylamino)-1-ethylpyrazolo[3,4-b]pyridine-5-carbonyl]hydrazinyl]-2-oxoethanesulfinic acid.
| Compound Name | 2-[2-[4-(cyclopentylamino)-1-ethylpyrazolo[3,4-b]pyridine-5-carbonyl]hydrazinyl]-2-oxoethanesulfinic acid |
|---|---|
| PubChem CID | 70343703 |
| Molecular Formula | C16H22N6O4S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-[2-[4-(cyclopentylamino)-1-ethylpyrazolo[3,4-b]pyridine-5-carbonyl]hydrazinyl]-2-oxoethanesulfinic acid |
| SMILES | CCn1ncc2c(NC3CCCC3)c(C(=O)NNC(=O)CS(=O)O)cnc21 |
| InChI | InChI=1S/C16H22N6O4S/c1-2-22-15-11(8-18-22)14(19-10-5-3-4-6-10)12(7-17-15)16(24)21-20-13(23)9-27(25)26/h7-8,10H,2-6,9H2,1H3,(H,17,19)(H,20,23)(H,21,24)(H,25,26) |
| InChIKey | CISBNOFZPVEOHZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 138.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|