C35H32N6O2 — CID 67530008
methyl 2-butyl-6-(2-phenylethenyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carboxylate (PubChem CID 67530008) has the molecular formula C35H32N6O2 and a molecular weight of 568.68 g/mol. Its IUPAC name is methyl 2-butyl-6-(2-phenylethenyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carboxylate.
| Compound Name | methyl 2-butyl-6-(2-phenylethenyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 67530008 |
| Molecular Formula | C35H32N6O2 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | methyl 2-butyl-6-(2-phenylethenyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carboxylate |
| SMILES | CCCCc1nc2cc(C=Cc3ccccc3)c(C(=O)OC)cc2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C35H32N6O2/c1-3-4-14-33-36-31-21-27(20-15-24-10-6-5-7-11-24)30(35(42)43-2)22-32(31)41(33)23-25-16-18-26(19-17-25)28-12-8-9-13-29(28)34-37-39-40-38-34/h5-13,15-22H,3-4,14,23H2,1-2H3,(H,37,38,39,40) |
| InChIKey | VIUIOKHMAPCCJJ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|