C36H35I3N6O2 — CID 91359403
iodoform;methyl 2-butyl-3-[[4-[2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methyl]-6-[(E)-2-phenylethenyl]benzimidazole-5-carboxylate (PubChem CID 91359403) has the molecular formula C36H35I3N6O2 and a molecular weight of 964.43 g/mol. Its IUPAC name is iodoform;methyl 2-butyl-3-[[4-[2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methyl]-6-[(E)-2-phenylethenyl]benzimidazole-5-carboxylate.
| Compound Name | iodoform;methyl 2-butyl-3-[[4-[2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methyl]-6-[(E)-2-phenylethenyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 91359403 |
| Molecular Formula | C36H35I3N6O2 |
| Molecular Weight | 964.43 g/mol |
| Exact Mass | 964.00 |
| IUPAC Name | iodoform;methyl 2-butyl-3-[[4-[2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]phenyl]methyl]-6-[(E)-2-phenylethenyl]benzimidazole-5-carboxylate |
| SMILES | CCCCc1nc2cc(/C=C/c3ccccc3)c(C(=O)OC)cc2n1Cc1ccc(-c2ccccc2C2=NNNN2)cc1.IC(I)I |
| InChI | InChI=1S/C35H34N6O2.CHI3/c1-3-4-14-33-36-31-21-27(20-15-24-10-6-5-7-11-24)30(35(42)43-2)22-32(31)41(33)23-25-16-18-26(19-17-25)28-12-8-9-13-29(28)34-37-39-40-38-34;2-1(3)4/h5-13,15-22,39-40H,3-4,14,23H2,1-2H3,(H,37,38);1H/b20-15+; |
| InChIKey | ZAUJOVCENZEMBQ-QMGGKDRNSA-N |
| XLogP | 8.90 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.43 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|