C11H15N3O3S — CID 67530085
4-(cyclopropylamino)-N-methyl-3-sulfamoylbenzamide (PubChem CID 67530085) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-methyl-3-sulfamoylbenzamide.
| Compound Name | 4-(cyclopropylamino)-N-methyl-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 67530085 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-(cyclopropylamino)-N-methyl-3-sulfamoylbenzamide |
| SMILES | CNC(=O)c1ccc(NC2CC2)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H15N3O3S/c1-13-11(15)7-2-5-9(14-8-3-4-8)10(6-7)18(12,16)17/h2,5-6,8,14H,3-4H2,1H3,(H,13,15)(H2,12,16,17) |
| InChIKey | GGMLDJUNLLZWQB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |