C21H16N2O2S — CID 67531139
2-amino-3-benzoyl-7-(4-methylphenyl)thieno[2,3-b]pyridin-6-one (PubChem CID 67531139) has the molecular formula C21H16N2O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-amino-3-benzoyl-7-(4-methylphenyl)thieno[2,3-b]pyridin-6-one.
| Compound Name | 2-amino-3-benzoyl-7-(4-methylphenyl)thieno[2,3-b]pyridin-6-one |
|---|---|
| PubChem CID | 67531139 |
| Molecular Formula | C21H16N2O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 2-amino-3-benzoyl-7-(4-methylphenyl)thieno[2,3-b]pyridin-6-one |
| SMILES | Cc1ccc(-n2c(=O)ccc3c(C(=O)c4ccccc4)c(N)sc32)cc1 |
| InChI | InChI=1S/C21H16N2O2S/c1-13-7-9-15(10-8-13)23-17(24)12-11-16-18(20(22)26-21(16)23)19(25)14-5-3-2-4-6-14/h2-12H,22H2,1H3 |
| InChIKey | UMETVZGRQZUQBK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |