C25H20N2O4S — CID 67532747
3-benzoyl-2-(morpholine-4-carbonyl)-7-phenylthieno[2,3-b]pyridin-6-one (PubChem CID 67532747) has the molecular formula C25H20N2O4S and a molecular weight of 444.51 g/mol. Its IUPAC name is 3-benzoyl-2-(morpholine-4-carbonyl)-7-phenylthieno[2,3-b]pyridin-6-one.
| Compound Name | 3-benzoyl-2-(morpholine-4-carbonyl)-7-phenylthieno[2,3-b]pyridin-6-one |
|---|---|
| PubChem CID | 67532747 |
| Molecular Formula | C25H20N2O4S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 3-benzoyl-2-(morpholine-4-carbonyl)-7-phenylthieno[2,3-b]pyridin-6-one |
| SMILES | O=C(c1ccccc1)c1c(C(=O)N2CCOCC2)sc2c1ccc(=O)n2-c1ccccc1 |
| InChI | InChI=1S/C25H20N2O4S/c28-20-12-11-19-21(22(29)17-7-3-1-4-8-17)23(24(30)26-13-15-31-16-14-26)32-25(19)27(20)18-9-5-2-6-10-18/h1-12H,13-16H2 |
| InChIKey | DKFFWRMXPHXAAT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |