About 4-cyclopropyl-8-fluoro-1λ6,2,4-benzothiadiazine 1,1-dioxide
4-cyclopropyl-8-fluoro-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 67531143) has the molecular formula C10H9FN2O2S
and a molecular weight of 240.26 g/mol. Its IUPAC name is 4-cyclopropyl-8-fluoro-1λ6,2,4-benzothiadiazine 1,1-dioxide.
Analyze 4-cyclopropyl-8-fluoro-1λ6,2,4-benzothiadiazine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-8-fluoro-1λ6,2,4-benzothiadiazine 1,1-dioxide?
The IUPAC name of 4-cyclopropyl-8-fluoro-1λ6,2,4-benzothiadiazine 1,1-dioxide (CID 67531143) is 4-cyclopropyl-8-fluoro-1λ6,2,4-benzothiadiazine 1,1-dioxide.
What is the SMILES notation for 4-cyclopropyl-8-fluoro-1λ6,2,4-benzothiadiazine 1,1-dioxide?
The canonical SMILES for 4-cyclopropyl-8-fluoro-1λ6,2,4-benzothiadiazine 1,1-dioxide is O=S1(=O)N=CN(C2CC2)c2cccc(F)c21.
What is the InChIKey of 4-cyclopropyl-8-fluoro-1λ6,2,4-benzothiadiazine 1,1-dioxide?
The InChIKey is WHNDUOSJLNBZPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2O2S/c11-8-2-1-3-9-10(8)16(14,15)12-6-13(9)7-4-5-7/h1-3,6-7H,4-5H2.
What are the key properties of 4-cyclopropyl-8-fluoro-1λ6,2,4-benzothiadiazine 1,1-dioxide?
4-cyclopropyl-8-fluoro-1λ6,2,4-benzothiadiazine 1,1-dioxide has a molecular weight of 240.26 g/mol, XLogP of 1.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-8-fluoro-1λ6,2,4-benzothiadiazine 1,1-dioxide is sourced from PubChem (CID 67531143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).