C14H19ClF2N2O2 — CID 67532009
1-[2-chloro-3-(difluoromethoxy)phenyl]-4-(2-methoxyethyl)piperazine (PubChem CID 67532009) has the molecular formula C14H19ClF2N2O2 and a molecular weight of 320.77 g/mol. Its IUPAC name is 1-[2-chloro-3-(difluoromethoxy)phenyl]-4-(2-methoxyethyl)piperazine.
| Compound Name | 1-[2-chloro-3-(difluoromethoxy)phenyl]-4-(2-methoxyethyl)piperazine |
|---|---|
| PubChem CID | 67532009 |
| Molecular Formula | C14H19ClF2N2O2 |
| Molecular Weight | 320.77 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 1-[2-chloro-3-(difluoromethoxy)phenyl]-4-(2-methoxyethyl)piperazine |
| SMILES | COCCN1CCN(c2cccc(OC(F)F)c2Cl)CC1 |
| InChI | InChI=1S/C14H19ClF2N2O2/c1-20-10-9-18-5-7-19(8-6-18)11-3-2-4-12(13(11)15)21-14(16)17/h2-4,14H,5-10H2,1H3 |
| InChIKey | PEWHDSUAXPGOTR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.77 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |