C16H16N4O3 — CID 67532011
(2S,3R)-3-[amino(3H-benzimidazol-5-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 67532011) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is (2S,3R)-3-[amino(3H-benzimidazol-5-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (2S,3R)-3-[amino(3H-benzimidazol-5-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 67532011 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (2S,3R)-3-[amino(3H-benzimidazol-5-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | NN(C(=O)[C@@H]1C2C=CC(C2)[C@@H]1C(=O)O)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C16H16N4O3/c17-20(10-3-4-11-12(6-10)19-7-18-11)15(21)13-8-1-2-9(5-8)14(13)16(22)23/h1-4,6-9,13-14H,5,17H2,(H,18,19)(H,22,23)/t8?,9?,13-,14+/m1/s1 |
| InChIKey | HQAIKPGKUYCAIS-YJBSTTGXSA-N |
| XLogP | 1.29 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|