C22H22FNO2 — CID 67532479
5-[3-[ethyl(naphthalen-1-yl)amino]propyl]-2-fluorobenzoic acid (PubChem CID 67532479) has the molecular formula C22H22FNO2 and a molecular weight of 351.42 g/mol. Its IUPAC name is 5-[3-[ethyl(naphthalen-1-yl)amino]propyl]-2-fluorobenzoic acid.
| Compound Name | 5-[3-[ethyl(naphthalen-1-yl)amino]propyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 67532479 |
| Molecular Formula | C22H22FNO2 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 5-[3-[ethyl(naphthalen-1-yl)amino]propyl]-2-fluorobenzoic acid |
| SMILES | CCN(CCCc1ccc(F)c(C(=O)O)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H22FNO2/c1-2-24(21-11-5-9-17-8-3-4-10-18(17)21)14-6-7-16-12-13-20(23)19(15-16)22(25)26/h3-5,8-13,15H,2,6-7,14H2,1H3,(H,25,26) |
| InChIKey | HTIJWPUMKWTQQR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |