C22H24N2O3 — CID 67532565
1'-(cyclopropylmethyl)-5'-(N-methylanilino)spiro[1,3-dioxane-2,3'-indole]-2'-one (PubChem CID 67532565) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1'-(cyclopropylmethyl)-5'-(N-methylanilino)spiro[1,3-dioxane-2,3'-indole]-2'-one.
| Compound Name | 1'-(cyclopropylmethyl)-5'-(N-methylanilino)spiro[1,3-dioxane-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 67532565 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1'-(cyclopropylmethyl)-5'-(N-methylanilino)spiro[1,3-dioxane-2,3'-indole]-2'-one |
| SMILES | CN(c1ccccc1)c1ccc2c(c1)C1(OCCCO1)C(=O)N2CC1CC1 |
| InChI | InChI=1S/C22H24N2O3/c1-23(17-6-3-2-4-7-17)18-10-11-20-19(14-18)22(26-12-5-13-27-22)21(25)24(20)15-16-8-9-16/h2-4,6-7,10-11,14,16H,5,8-9,12-13,15H2,1H3 |
| InChIKey | ONLDBMBWOPSMMW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|