About [4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl-[5-(trifluoromethyl)pyrimidin-2-yl]carbamic acid
[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl-[5-(trifluoromethyl)pyrimidin-2-yl]carbamic acid (PubChem CID 67532607) has the molecular formula C17H15Cl2F3N4O2
and a molecular weight of 435.23 g/mol. Its IUPAC name is [4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl-[5-(trifluoromethyl)pyrimidin-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl-[5-(trifluoromethyl)pyrimidin-2-yl]carbamic acid |
| PubChem CID | 67532607 |
| Molecular Formula | C17H15Cl2F3N4O2 |
| Molecular Weight | 435.23 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | [4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl-[5-(trifluoromethyl)pyrimidin-2-yl]carbamic acid |
| SMILES | O=C(O)N(CC1CNCC1c1ccc(Cl)c(Cl)c1)c1ncc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C17H15Cl2F3N4O2/c18-13-2-1-9(3-14(13)19)12-7-23-4-10(12)8-26(16(27)28)15-24-5-11(6-25-15)17(20,21)22/h1-3,5-6,10,12,23H,4,7-8H2,(H,27,28) |
| InChIKey | IQOWTKCZUUKJOQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.23 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl-[5-(trifluoromethyl)pyrimidin-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl-[5-(trifluoromethyl)pyrimidin-2-yl]carbamic acid?
The IUPAC name of [4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl-[5-(trifluoromethyl)pyrimidin-2-yl]carbamic acid (CID 67532607) is [4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl-[5-(trifluoromethyl)pyrimidin-2-yl]carbamic acid.
What is the SMILES notation for [4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl-[5-(trifluoromethyl)pyrimidin-2-yl]carbamic acid?
The canonical SMILES for [4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl-[5-(trifluoromethyl)pyrimidin-2-yl]carbamic acid is O=C(O)N(CC1CNCC1c1ccc(Cl)c(Cl)c1)c1ncc(C(F)(F)F)cn1.
What is the InChIKey of [4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl-[5-(trifluoromethyl)pyrimidin-2-yl]carbamic acid?
The InChIKey is IQOWTKCZUUKJOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Cl2F3N4O2/c18-13-2-1-9(3-14(13)19)12-7-23-4-10(12)8-26(16(27)28)15-24-5-11(6-25-15)17(20,21)22/h1-3,5-6,10,12,23H,4,7-8H2,(H,27,28).
What are the key properties of [4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl-[5-(trifluoromethyl)pyrimidin-2-yl]carbamic acid?
[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl-[5-(trifluoromethyl)pyrimidin-2-yl]carbamic acid has a molecular weight of 435.23 g/mol, XLogP of 4.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl-[5-(trifluoromethyl)pyrimidin-2-yl]carbamic acid is sourced from PubChem (CID 67532607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).