C8H10O3 — CID 67533518
(1R,5S)-1-methyl-8-oxabicyclo[3.2.1]octane-2,4-dione (PubChem CID 67533518) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is (1R,5S)-1-methyl-8-oxabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1R,5S)-1-methyl-8-oxabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 67533518 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (1R,5S)-1-methyl-8-oxabicyclo[3.2.1]octane-2,4-dione |
| SMILES | C[C@]12CC[C@H](O1)C(=O)CC2=O |
| InChI | InChI=1S/C8H10O3/c1-8-3-2-6(11-8)5(9)4-7(8)10/h6H,2-4H2,1H3/t6-,8+/m0/s1 |
| InChIKey | DJICEWXPHFJMTC-POYBYMJQSA-N |
| XLogP | 0.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|