C10H17N3O2 — CID 67537380
5-[1-[(2-methoxyethylamino)methyl]cyclopropyl]-1,2-oxazol-3-amine (PubChem CID 67537380) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 5-[1-[(2-methoxyethylamino)methyl]cyclopropyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[1-[(2-methoxyethylamino)methyl]cyclopropyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 67537380 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 5-[1-[(2-methoxyethylamino)methyl]cyclopropyl]-1,2-oxazol-3-amine |
| SMILES | COCCNCC1(c2cc(N)no2)CC1 |
| InChI | InChI=1S/C10H17N3O2/c1-14-5-4-12-7-10(2-3-10)8-6-9(11)13-15-8/h6,12H,2-5,7H2,1H3,(H2,11,13) |
| InChIKey | WETMCEZXIUMKQZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|