C23H36N2O2 — CID 69451809
2-(4,4-dimethylcyclohexen-1-yl)-4-[4-[(2-methoxyethylamino)methyl]oxan-4-yl]aniline (PubChem CID 69451809) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is 2-(4,4-dimethylcyclohexen-1-yl)-4-[4-[(2-methoxyethylamino)methyl]oxan-4-yl]aniline.
| Compound Name | 2-(4,4-dimethylcyclohexen-1-yl)-4-[4-[(2-methoxyethylamino)methyl]oxan-4-yl]aniline |
|---|---|
| PubChem CID | 69451809 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | 2-(4,4-dimethylcyclohexen-1-yl)-4-[4-[(2-methoxyethylamino)methyl]oxan-4-yl]aniline |
| SMILES | COCCNCC1(c2ccc(N)c(C3=CCC(C)(C)CC3)c2)CCOCC1 |
| InChI | InChI=1S/C23H36N2O2/c1-22(2)8-6-18(7-9-22)20-16-19(4-5-21(20)24)23(10-13-27-14-11-23)17-25-12-15-26-3/h4-6,16,25H,7-15,17,24H2,1-3H3 |
| InChIKey | TXTJWSFIPGLWLQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|