C20H30N2O — CID 69453328
4-[4-(aminomethyl)oxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)aniline (PubChem CID 69453328) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is 4-[4-(aminomethyl)oxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)aniline.
| Compound Name | 4-[4-(aminomethyl)oxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)aniline |
|---|---|
| PubChem CID | 69453328 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 4-[4-(aminomethyl)oxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)aniline |
| SMILES | CC1(C)CC=C(c2cc(C3(CN)CCOCC3)ccc2N)CC1 |
| InChI | InChI=1S/C20H30N2O/c1-19(2)7-5-15(6-8-19)17-13-16(3-4-18(17)22)20(14-21)9-11-23-12-10-20/h3-5,13H,6-12,14,21-22H2,1-2H3 |
| InChIKey | URRJDQUSOSLDKD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|