C21H30N2O2 — CID 68836947
4-[4-(aminomethyl)oxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)benzamide (PubChem CID 68836947) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 4-[4-(aminomethyl)oxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)benzamide.
| Compound Name | 4-[4-(aminomethyl)oxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)benzamide |
|---|---|
| PubChem CID | 68836947 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 4-[4-(aminomethyl)oxan-4-yl]-2-(4,4-dimethylcyclohexen-1-yl)benzamide |
| SMILES | CC1(C)CC=C(c2cc(C3(CN)CCOCC3)ccc2C(N)=O)CC1 |
| InChI | InChI=1S/C21H30N2O2/c1-20(2)7-5-15(6-8-20)18-13-16(3-4-17(18)19(23)24)21(14-22)9-11-25-12-10-21/h3-5,13H,6-12,14,22H2,1-2H3,(H2,23,24) |
| InChIKey | OYFIDDSYHWSYNT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |