C26H38N2O7 — CID 67537813
1-(1-cyclohexyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-[[(1R,2R)-1,2-dihydroxycyclohexyl]methylamino]ethanone;oxalic acid (PubChem CID 67537813) has the molecular formula C26H38N2O7 and a molecular weight of 490.60 g/mol. Its IUPAC name is 1-(1-cyclohexyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-[[(1R,2R)-1,2-dihydroxycyclohexyl]methylamino]ethanone;oxalic acid.
| Compound Name | 1-(1-cyclohexyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-[[(1R,2R)-1,2-dihydroxycyclohexyl]methylamino]ethanone;oxalic acid |
|---|---|
| PubChem CID | 67537813 |
| Molecular Formula | C26H38N2O7 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 1-(1-cyclohexyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-[[(1R,2R)-1,2-dihydroxycyclohexyl]methylamino]ethanone;oxalic acid |
| SMILES | O=C(CNC[C@]1(O)CCCC[C@H]1O)N1CCc2ccccc2C1C1CCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H36N2O3.C2H2O4/c27-21-12-6-7-14-24(21,29)17-25-16-22(28)26-15-13-18-8-4-5-11-20(18)23(26)19-9-2-1-3-10-19;3-1(4)2(5)6/h4-5,8,11,19,21,23,25,27,29H,1-3,6-7,9-10,12-17H2;(H,3,4)(H,5,6)/t21-,23?,24-;/m1./s1 |
| InChIKey | GXTJVASMWNYFDC-QBMMFAFJSA-N |
| XLogP | 2.10 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|