C27H39N3O7 — CID 67537629
1-cyclohexyl-2-[2-[(1-hydroxycyclohexyl)methylamino]acetyl]-3,4-dihydro-1H-isoquinoline-6-carboxamide;oxalic acid (PubChem CID 67537629) has the molecular formula C27H39N3O7 and a molecular weight of 517.62 g/mol. Its IUPAC name is 1-cyclohexyl-2-[2-[(1-hydroxycyclohexyl)methylamino]acetyl]-3,4-dihydro-1H-isoquinoline-6-carboxamide;oxalic acid.
| Compound Name | 1-cyclohexyl-2-[2-[(1-hydroxycyclohexyl)methylamino]acetyl]-3,4-dihydro-1H-isoquinoline-6-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 67537629 |
| Molecular Formula | C27H39N3O7 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | 1-cyclohexyl-2-[2-[(1-hydroxycyclohexyl)methylamino]acetyl]-3,4-dihydro-1H-isoquinoline-6-carboxamide;oxalic acid |
| SMILES | NC(=O)c1ccc2c(c1)CCN(C(=O)CNCC1(O)CCCCC1)C2C1CCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H37N3O3.C2H2O4/c26-24(30)20-9-10-21-19(15-20)11-14-28(23(21)18-7-3-1-4-8-18)22(29)16-27-17-25(31)12-5-2-6-13-25;3-1(4)2(5)6/h9-10,15,18,23,27,31H,1-8,11-14,16-17H2,(H2,26,30);(H,3,4)(H,5,6) |
| InChIKey | VTMNADQIHXPLJX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|