C20H28ClNO2 — CID 59396587
2-chloro-1-[1-cyclohexyl-6-(2-hydroxypropan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone (PubChem CID 59396587) has the molecular formula C20H28ClNO2 and a molecular weight of 349.90 g/mol. Its IUPAC name is 2-chloro-1-[1-cyclohexyl-6-(2-hydroxypropan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone.
| Compound Name | 2-chloro-1-[1-cyclohexyl-6-(2-hydroxypropan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 59396587 |
| Molecular Formula | C20H28ClNO2 |
| Molecular Weight | 349.90 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-chloro-1-[1-cyclohexyl-6-(2-hydroxypropan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
| SMILES | CC(C)(O)c1ccc2c(c1)CCN(C(=O)CCl)C2C1CCCCC1 |
| InChI | InChI=1S/C20H28ClNO2/c1-20(2,24)16-8-9-17-15(12-16)10-11-22(18(23)13-21)19(17)14-6-4-3-5-7-14/h8-9,12,14,19,24H,3-7,10-11,13H2,1-2H3 |
| InChIKey | LOJIHLDWEWMOMI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.90 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|