C26H30ClF2NO3 — CID 58858165
tert-butyl 6-[(3-chloro-2,6-difluorophenyl)methoxy]-1-cyclopentyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 58858165) has the molecular formula C26H30ClF2NO3 and a molecular weight of 477.98 g/mol. Its IUPAC name is tert-butyl 6-[(3-chloro-2,6-difluorophenyl)methoxy]-1-cyclopentyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 6-[(3-chloro-2,6-difluorophenyl)methoxy]-1-cyclopentyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 58858165 |
| Molecular Formula | C26H30ClF2NO3 |
| Molecular Weight | 477.98 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | tert-butyl 6-[(3-chloro-2,6-difluorophenyl)methoxy]-1-cyclopentyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(OCc3c(F)ccc(Cl)c3F)ccc2C1C1CCCC1 |
| InChI | InChI=1S/C26H30ClF2NO3/c1-26(2,3)33-25(31)30-13-12-17-14-18(8-9-19(17)24(30)16-6-4-5-7-16)32-15-20-22(28)11-10-21(27)23(20)29/h8-11,14,16,24H,4-7,12-13,15H2,1-3H3 |
| InChIKey | SJVYCUNRXWXXHY-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.98 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|