C18H17F3O3 — CID 67538441
2-[4-(2,2-difluoro-2-phenylethoxy)-3-fluorophenyl]butanoic acid (PubChem CID 67538441) has the molecular formula C18H17F3O3 and a molecular weight of 338.32 g/mol. Its IUPAC name is 2-[4-(2,2-difluoro-2-phenylethoxy)-3-fluorophenyl]butanoic acid.
| Compound Name | 2-[4-(2,2-difluoro-2-phenylethoxy)-3-fluorophenyl]butanoic acid |
|---|---|
| PubChem CID | 67538441 |
| Molecular Formula | C18H17F3O3 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-[4-(2,2-difluoro-2-phenylethoxy)-3-fluorophenyl]butanoic acid |
| SMILES | CCC(C(=O)O)c1ccc(OCC(F)(F)c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C18H17F3O3/c1-2-14(17(22)23)12-8-9-16(15(19)10-12)24-11-18(20,21)13-6-4-3-5-7-13/h3-10,14H,2,11H2,1H3,(H,22,23) |
| InChIKey | WUNVFKAFGXWEPL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |