C24H21NO4 — CID 67543516
(2S)-2-(2-benzoyl-N-ethenylanilino)-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 67543516) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is (2S)-2-(2-benzoyl-N-ethenylanilino)-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-(2-benzoyl-N-ethenylanilino)-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 67543516 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (2S)-2-(2-benzoyl-N-ethenylanilino)-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | C=CN(c1ccccc1C(=O)c1ccccc1)[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C24H21NO4/c1-2-25(22(24(28)29)16-17-12-14-19(26)15-13-17)21-11-7-6-10-20(21)23(27)18-8-4-3-5-9-18/h2-15,22,26H,1,16H2,(H,28,29)/t22-/m0/s1 |
| InChIKey | OFTRFIGZEIHMED-QFIPXVFZSA-N |
| XLogP | 4.27 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |