C18H31N3O — CID 67545933
2-piperidin-4-yl-3-[(2R)-2-pyrrolidin-1-ylbutoxy]-1,2-dihydropyridine (PubChem CID 67545933) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is 2-piperidin-4-yl-3-[(2R)-2-pyrrolidin-1-ylbutoxy]-1,2-dihydropyridine.
| Compound Name | 2-piperidin-4-yl-3-[(2R)-2-pyrrolidin-1-ylbutoxy]-1,2-dihydropyridine |
|---|---|
| PubChem CID | 67545933 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | 2-piperidin-4-yl-3-[(2R)-2-pyrrolidin-1-ylbutoxy]-1,2-dihydropyridine |
| SMILES | CC[C@H](COC1=CC=CNC1C1CCNCC1)N1CCCC1 |
| InChI | InChI=1S/C18H31N3O/c1-2-16(21-12-3-4-13-21)14-22-17-6-5-9-20-18(17)15-7-10-19-11-8-15/h5-6,9,15-16,18-20H,2-4,7-8,10-14H2,1H3/t16-,18?/m1/s1 |
| InChIKey | RFOAVAMKCKZUDG-PYUWXLGESA-N |
| XLogP | 2.25 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |