C15H19N3S — CID 67550602
2-(2,6-dimethylphenyl)-4-(1H-imidazol-2-yl)thiomorpholine (PubChem CID 67550602) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-4-(1H-imidazol-2-yl)thiomorpholine.
| Compound Name | 2-(2,6-dimethylphenyl)-4-(1H-imidazol-2-yl)thiomorpholine |
|---|---|
| PubChem CID | 67550602 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-4-(1H-imidazol-2-yl)thiomorpholine |
| SMILES | Cc1cccc(C)c1C1CN(c2ncc[nH]2)CCS1 |
| InChI | InChI=1S/C15H19N3S/c1-11-4-3-5-12(2)14(11)13-10-18(8-9-19-13)15-16-6-7-17-15/h3-7,13H,8-10H2,1-2H3,(H,16,17) |
| InChIKey | OWPJVZQSPVFMKG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |