C29H41N5O6 — CID 67552154
tert-butyl N-[[(2S,3S,5S)-7-amino-3-[amino(phenyl)methyl]-5-benzamido-2-hydroxy-4,7-dioxoheptyl]-propan-2-ylamino]carbamate (PubChem CID 67552154) has the molecular formula C29H41N5O6 and a molecular weight of 555.68 g/mol. Its IUPAC name is tert-butyl N-[[(2S,3S,5S)-7-amino-3-[amino(phenyl)methyl]-5-benzamido-2-hydroxy-4,7-dioxoheptyl]-propan-2-ylamino]carbamate.
| Compound Name | tert-butyl N-[[(2S,3S,5S)-7-amino-3-[amino(phenyl)methyl]-5-benzamido-2-hydroxy-4,7-dioxoheptyl]-propan-2-ylamino]carbamate |
|---|---|
| PubChem CID | 67552154 |
| Molecular Formula | C29H41N5O6 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | tert-butyl N-[[(2S,3S,5S)-7-amino-3-[amino(phenyl)methyl]-5-benzamido-2-hydroxy-4,7-dioxoheptyl]-propan-2-ylamino]carbamate |
| SMILES | CC(C)N(C[C@@H](O)[C@@H](C(=O)[C@H](CC(N)=O)NC(=O)c1ccccc1)C(N)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H41N5O6/c1-18(2)34(33-28(39)40-29(3,4)5)17-22(35)24(25(31)19-12-8-6-9-13-19)26(37)21(16-23(30)36)32-27(38)20-14-10-7-11-15-20/h6-15,18,21-22,24-25,35H,16-17,31H2,1-5H3,(H2,30,36)(H,32,38)(H,33,39)/t21-,22+,24+,25?/m0/s1 |
| InChIKey | HWMUNULDVINQFU-USFLLVAPSA-N |
| XLogP | 2.06 |
| TPSA | 177.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|