C23H17BrN6O — CID 67552441
N-[4-bromo-2-(2H-tetrazol-5-yl)phenyl]-1-methyl-7-phenylindole-2-carboxamide (PubChem CID 67552441) has the molecular formula C23H17BrN6O and a molecular weight of 473.33 g/mol. Its IUPAC name is N-[4-bromo-2-(2H-tetrazol-5-yl)phenyl]-1-methyl-7-phenylindole-2-carboxamide.
| Compound Name | N-[4-bromo-2-(2H-tetrazol-5-yl)phenyl]-1-methyl-7-phenylindole-2-carboxamide |
|---|---|
| PubChem CID | 67552441 |
| Molecular Formula | C23H17BrN6O |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | N-[4-bromo-2-(2H-tetrazol-5-yl)phenyl]-1-methyl-7-phenylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccc(Br)cc2-c2nn[nH]n2)cc2cccc(-c3ccccc3)c21 |
| InChI | InChI=1S/C23H17BrN6O/c1-30-20(12-15-8-5-9-17(21(15)30)14-6-3-2-4-7-14)23(31)25-19-11-10-16(24)13-18(19)22-26-28-29-27-22/h2-13H,1H3,(H,25,31)(H,26,27,28,29) |
| InChIKey | SXUXGIOVKQTRLW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |